CAS 10007-84-8 appears in our catalog under these names: Sodium 2,6-dichlorobenzoate, 97%, Sodium 2,6-dichlorobenzoate 97%, Sodium 2,6-dichlorobenzoate, 97%, 97%, SODIUM 2,6-DICHLOROBENZOATE, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100g, 25g, 500g, 10g.
Sodium 2,6-dichlorobenzoate (CAS 10007-84-8) is a chemical compound with the molecular formula C7H3Cl2NaO2 and a molecular weight of 212.99 g/mol. IUPAC name: sodium 2,6-dichlorobenzoate. InChIKey: LZSRENODTOCXKJ-UHFFFAOYSA-M.
| Molecular formula | C7H3Cl2NaO2 |
|---|---|
| Molecular weight | 212.99 g/mol |
| IUPAC name | sodium 2,6-dichlorobenzoate |
| InChIKey | LZSRENODTOCXKJ-UHFFFAOYSA-M |
| SMILES | C1=CC(=C(C(=C1)Cl)C(=O)[O-])Cl.[Na+] |
Computed by PubChem (NCBI)