CAS 38402-11-8 appears in our catalog under these names: Sodium 2,4-dichlorobenzoate, 95%, Sodium 2,4-dichlorobenzoate, 97%, Sodium 2,4–dichlorobenzoate. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 25g, 5g, 1g, 100g.
Sodium 2,4-dichlorobenzoate (CAS 38402-11-8) is a chemical compound with the molecular formula C7H3Cl2NaO2 and a molecular weight of 212.99 g/mol. IUPAC name: sodium 2,4-dichlorobenzoate. InChIKey: XVYLSIXULOLXJR-UHFFFAOYSA-M.
| Molecular formula | C7H3Cl2NaO2 |
|---|---|
| Molecular weight | 212.99 g/mol |
| IUPAC name | sodium 2,4-dichlorobenzoate |
| InChIKey | XVYLSIXULOLXJR-UHFFFAOYSA-M |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)