CAS 63891-98-5 appears in our catalog under these names: Sodium 2,5-dichlorobenzoate, 95%, Sodium 2,5-dichlorobenzoate 97%, Sodium 2,5-dichlorobenzoate, 97%, 97%, Sodium 2,5-dichlorobenzoate, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 100g.
Sodium 2,5-dichlorobenzoate (CAS 63891-98-5) is a chemical compound with the molecular formula C7H3Cl2NaO2 and a molecular weight of 212.99 g/mol. IUPAC name: sodium 2,5-dichlorobenzoate. InChIKey: CXIPPGIFARBNFA-UHFFFAOYSA-M.
| Molecular formula | C7H3Cl2NaO2 |
|---|---|
| Molecular weight | 212.99 g/mol |
| IUPAC name | sodium 2,5-dichlorobenzoate |
| InChIKey | CXIPPGIFARBNFA-UHFFFAOYSA-M |
| SMILES | C1=CC(=C(C=C1Cl)C(=O)[O-])Cl.[Na+] |
Computed by PubChem (NCBI)