Products 118537-84-1
CAS 118537-84-1 is the registry number for Sodium 2,3-dichlorobenzoate, 94%. Offered by: Fluorochem. Available pack sizes: 1g, 5g.
Sodium 2,3-dichlorobenzoate (CAS 118537-84-1) is a chemical compound with the molecular formula C7H3Cl2NaO2 and a molecular weight of 212.99 g/mol. IUPAC name: sodium 2,3-dichlorobenzoate. InChIKey: LEWSUBAQHLVATO-UHFFFAOYSA-M.
| Molecular formula | C7H3Cl2NaO2 |
|---|---|
| Molecular weight | 212.99 g/mol |
| IUPAC name | sodium 2,3-dichlorobenzoate |
| InChIKey | LEWSUBAQHLVATO-UHFFFAOYSA-M |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)