Products 10009-25-3
CAS 10009-25-3 appears in our catalog under these names: 4-(1,1,2,2-Tetrafluoroethoxy)benzoic acid, 98%, 4–(1，1，2，2–Tetrafluoroethoxy)benzoic Acid, 4-(1,1,2,2-Tetrafluoroethoxy)benzoic Acid, >98.0%(GC)(T), 4-(1,1,2,2-Tetrafluoroethoxy)benzoic acid, 97%, 4-(1,1,2,2-Tetrafluoroethoxy)benzoic Acid, 98.0%, 98.0%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Fluorochem. Available pack sizes: 25g, 100g, 1g, 500g, 5g.
4-(1,1,2,2-tetrafluoroethoxy)benzoic acid (CAS 10009-25-3) is a chemical compound with the molecular formula C9H6F4O3 and a molecular weight of 238.14 g/mol. IUPAC name: 4-(1,1,2,2-tetrafluoroethoxy)benzoic acid. InChIKey: SVGWTILJZWYEMD-UHFFFAOYSA-N.
| Molecular formula | C9H6F4O3 |
|---|---|
| Molecular weight | 238.14 g/mol |
| IUPAC name | 4-(1,1,2,2-tetrafluoroethoxy)benzoic acid |
| InChIKey | SVGWTILJZWYEMD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)OC(C(F)F)(F)F |
Computed by PubChem (NCBI)