CAS 444919-46-4 appears in our catalog under these names: 6-(Hydroxymethyl)-2,2,3,3-tetrafluoro-1,4-benzodioxane, 95%, 6-(Hydroxymethyl)-2,2,3,3-tetrafluoro-1,4-benzodioxane, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)methanol (CAS 444919-46-4) is a chemical compound with the molecular formula C9H6F4O3 and a molecular weight of 238.14 g/mol. IUPAC name: (2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)methanol. InChIKey: CXYBLVMTKMJBRX-UHFFFAOYSA-N.
| Molecular formula | C9H6F4O3 |
|---|---|
| Molecular weight | 238.14 g/mol |
| IUPAC name | (2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)methanol |
| InChIKey | CXYBLVMTKMJBRX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1CO)OC(C(O2)(F)F)(F)F |
Computed by PubChem (NCBI)