CAS 1352999-94-0 appears in our catalog under these names: 3-Fluoro-5-(trifluoromethoxy)phenylacetic acid, 95%, 2-(3-Fluoro-5-(trifluoromethoxy)phenyl)acetic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
2-[3-fluoro-5-(trifluoromethoxy)phenyl]acetic acid (CAS 1352999-94-0) is a chemical compound with the molecular formula C9H6F4O3 and a molecular weight of 238.14 g/mol. IUPAC name: 2-[3-fluoro-5-(trifluoromethoxy)phenyl]acetic acid. InChIKey: LEUVGYUDBIAFFK-UHFFFAOYSA-N.
| Molecular formula | C9H6F4O3 |
|---|---|
| Molecular weight | 238.14 g/mol |
| IUPAC name | 2-[3-fluoro-5-(trifluoromethoxy)phenyl]acetic acid |
| InChIKey | LEUVGYUDBIAFFK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1OC(F)(F)F)F)CC(=O)O |
Computed by PubChem (NCBI)