Products 2244107-74-0

CAS 2244107-74-0 is the registry number for 5-Fluoro-4-methoxy-3-(trifluoromethyl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

3-fluoro-4-methoxy-5-(trifluoromethyl)benzoic acid (CAS 2244107-74-0) is a chemical compound with the molecular formula C9H6F4O3 and a molecular weight of 238.14 g/mol. IUPAC name: 3-fluoro-4-methoxy-5-(trifluoromethyl)benzoic acid. InChIKey: ZWBNYDCDHMIGGU-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6F4O3
Molecular weight238.14 g/mol
IUPAC name3-fluoro-4-methoxy-5-(trifluoromethyl)benzoic acid
InChIKeyZWBNYDCDHMIGGU-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1F)C(=O)O)C(F)(F)F

Computed by PubChem (NCBI)