Products 1000932-84-2
CAS 1000932-84-2 is the registry number for N-{4-(1-(Hydroxyimino)ethyl)phenyl}cyclopropanecarboxamide. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
N-[4-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenyl]cyclopropanecarboxamide (CAS 1000932-84-2) is a chemical compound with the molecular formula C12H14N2O2 and a molecular weight of 218.25 g/mol. IUPAC name: N-[4-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenyl]cyclopropanecarboxamide. InChIKey: DCPRNHHMNTWKPK-RIYZIHGNSA-N.
| Molecular formula | C12H14N2O2 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | N-[4-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenyl]cyclopropanecarboxamide |
| InChIKey | DCPRNHHMNTWKPK-RIYZIHGNSA-N |
| SMILES | C/C(=N\O)/C1=CC=C(C=C1)NC(=O)C2CC2 |
Computed by PubChem (NCBI)