CAS 1000932-94-4 is the registry number for 1-(3-(2H-1,3-Benzodioxol-5-yl)-1,2,4-oxadiazol-5-yl)propan-2-one, 95%. Offered by: AmBeed. Available pack sizes: 5g.
1-[3-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-5-yl]propan-2-one (CAS 1000932-94-4) is a chemical compound with the molecular formula C12H10N2O4 and a molecular weight of 246.22 g/mol. IUPAC name: 1-[3-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-5-yl]propan-2-one. InChIKey: KJSDWQGFYFGMES-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O4 |
|---|---|
| Molecular weight | 246.22 g/mol |
| IUPAC name | 1-[3-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-5-yl]propan-2-one |
| InChIKey | KJSDWQGFYFGMES-UHFFFAOYSA-N |
| SMILES | CC(=O)CC1=NC(=NO1)C2=CC3=C(C=C2)OCO3 |
Computed by PubChem (NCBI)