Products 1000933-25-4
CAS 1000933-25-4 appears in our catalog under these names: 2-Chloropyridine-4-sulfonyl chloride, 97%, 2-Chloropyridine-4-sulfonyl chloride, 90%, 2-Chloro-4-pyridinesulfonyl chloride, 97%. Offered by: Fluorochem, Ambeed, Chemat. Available pack sizes: 100mg, 50mg, 250mg, 1g.
2-chloropyridine-4-sulfonyl chloride (CAS 1000933-25-4) is a chemical compound with the molecular formula C5H3Cl2NO2S and a molecular weight of 212.05 g/mol. IUPAC name: 2-chloropyridine-4-sulfonyl chloride. InChIKey: YQKSHKJJXUAFAN-UHFFFAOYSA-N.
| Molecular formula | C5H3Cl2NO2S |
|---|---|
| Molecular weight | 212.05 g/mol |
| IUPAC name | 2-chloropyridine-4-sulfonyl chloride |
| InChIKey | YQKSHKJJXUAFAN-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)