Products 1000933-25-4

CAS 1000933-25-4 appears in our catalog under these names: 2-Chloropyridine-4-sulfonyl chloride 90%, 2-Chloropyridine-4-sulfonyl chloride, 97%, 2-Chloro-4-pyridinesulfonyl chloride, 90%, 90%. Offered by: Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

2-chloropyridine-4-sulfonyl chloride (CAS 1000933-25-4) is a chemical compound with the molecular formula C5H3Cl2NO2S and a molecular weight of 212.05 g/mol. IUPAC name: 2-chloropyridine-4-sulfonyl chloride. InChIKey: YQKSHKJJXUAFAN-UHFFFAOYSA-N.

Identity
Molecular formulaC5H3Cl2NO2S
Molecular weight212.05 g/mol
IUPAC name2-chloropyridine-4-sulfonyl chloride
InChIKeyYQKSHKJJXUAFAN-UHFFFAOYSA-N
SMILESC1=CN=C(C=C1S(=O)(=O)Cl)Cl

Computed by PubChem (NCBI)