CAS 885277-08-7 appears in our catalog under these names: 5-Chloro-pyridine-2-sulfonyl chloride, 95%, 5–Chloropyridine–2–sulfonyl chloride, 5-Chloropyridine-2-sulfonyl chloride 98%, 5-Chloropyridine-2-sulfonyl chloride, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 100mg.
5-chloropyridine-2-sulfonyl chloride (CAS 885277-08-7) is a chemical compound with the molecular formula C5H3Cl2NO2S and a molecular weight of 212.05 g/mol. IUPAC name: 5-chloropyridine-2-sulfonyl chloride. InChIKey: ZPHYQPBAPHPVAL-UHFFFAOYSA-N.
| Molecular formula | C5H3Cl2NO2S |
|---|---|
| Molecular weight | 212.05 g/mol |
| IUPAC name | 5-chloropyridine-2-sulfonyl chloride |
| InChIKey | ZPHYQPBAPHPVAL-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)