CAS 6684-39-5 appears in our catalog under these names: 2-Chloro-5-pyridinesulfonyl chloride 97%, 2-Chloro-5-pyridinesulfonyl chloride, 95%, 2-Chloro-5-pyridinesulfonyl chloride, 97%, 97%, 6-Chloropyridine-3-sulfonyl chloride. Offered by: Ambeed, Fluorochem, Chemat, Biosynth. Available pack sizes: 1g, 5g, 25g, 10g, 50g, 100g, 2g, 0,5g.
6-chloropyridine-3-sulfonyl chloride (CAS 6684-39-5) is a chemical compound with the molecular formula C5H3Cl2NO2S and a molecular weight of 212.05 g/mol. IUPAC name: 6-chloropyridine-3-sulfonyl chloride. InChIKey: QXZKKHONVQGXAK-UHFFFAOYSA-N.
| Molecular formula | C5H3Cl2NO2S |
|---|---|
| Molecular weight | 212.05 g/mol |
| IUPAC name | 6-chloropyridine-3-sulfonyl chloride |
| InChIKey | QXZKKHONVQGXAK-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)