CAS 33263-44-4 appears in our catalog under these names: 4-chloropyridine-3-sulfonyl chloride, 4-Chloropyridine-3-sulfonyl chloride, 95%, 4-Chloropyridine-3-sulfonyl chloride 95%, 4-Chloropyridine-3-sulfonyl chloride, 97%, 4-Chloro-3-pyridinesulfonyl chloride, 98%, 98%. Offered by: Biosynth, Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 10g, 1g, 5g, 100mg, 250mg, 50mg, 500mg, 2.5g.
4-chloropyridine-3-sulfonyl chloride (CAS 33263-44-4) is a chemical compound with the molecular formula C5H3Cl2NO2S and a molecular weight of 212.05 g/mol. IUPAC name: 4-chloropyridine-3-sulfonyl chloride. InChIKey: KCNWYJPUGJYMNO-UHFFFAOYSA-N.
| Molecular formula | C5H3Cl2NO2S |
|---|---|
| Molecular weight | 212.05 g/mol |
| IUPAC name | 4-chloropyridine-3-sulfonyl chloride |
| InChIKey | KCNWYJPUGJYMNO-UHFFFAOYSA-N |
| SMILES | C1=CN=CC(=C1Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)