CAS 1000933-89-0 appears in our catalog under these names: 8-Fluoroquinoline-5-sulfonyl chloride, 95%, 8-Fluoroquinoline-5-sulfonyl chloride 95%, 8-FLUOROQUINOLINE-5-SULFONYL CHLORIDE, 95%, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 100mg, 250mg, 1g, 25g.
8-fluoroquinoline-5-sulfonyl chloride (CAS 1000933-89-0) is a chemical compound with the molecular formula C9H5ClFNO2S and a molecular weight of 245.66 g/mol. IUPAC name: 8-fluoroquinoline-5-sulfonyl chloride. InChIKey: WFHNJMBOSBJIPK-UHFFFAOYSA-N.
| Molecular formula | C9H5ClFNO2S |
|---|---|
| Molecular weight | 245.66 g/mol |
| IUPAC name | 8-fluoroquinoline-5-sulfonyl chloride |
| InChIKey | WFHNJMBOSBJIPK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2N=C1)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)