CAS 32435-65-7 is the registry number for 7-Fluoro-8-Quinolinesulfonyl Chloride. Offered by: TRC. Available pack sizes: 250mg.
7-fluoroquinoline-8-sulfonyl chloride (CAS 32435-65-7) is a chemical compound with the molecular formula C9H5ClFNO2S and a molecular weight of 245.66 g/mol. IUPAC name: 7-fluoroquinoline-8-sulfonyl chloride. InChIKey: JLDQKSWUOLQECM-UHFFFAOYSA-N.
| Molecular formula | C9H5ClFNO2S |
|---|---|
| Molecular weight | 245.66 g/mol |
| IUPAC name | 7-fluoroquinoline-8-sulfonyl chloride |
| InChIKey | JLDQKSWUOLQECM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C(C=C2)F)S(=O)(=O)Cl)N=C1 |
Computed by PubChem (NCBI)