CAS 194032-33-2 appears in our catalog under these names: 4-Fluoroisoquinoline-5-sulfonyl chloride, 95%, 4-Fluoroisoquinoline-5-sulfonyl chloride, 98+%, 4-Fluoroisoquinoline-5-sulfonyl chloride, 98%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 250mg, 5g.
4-fluoroisoquinoline-5-sulfonyl chloride (CAS 194032-33-2) is a chemical compound with the molecular formula C9H5ClFNO2S and a molecular weight of 245.66 g/mol. IUPAC name: 4-fluoroisoquinoline-5-sulfonyl chloride. InChIKey: UZUCKWMDQGESLP-UHFFFAOYSA-N.
| Molecular formula | C9H5ClFNO2S |
|---|---|
| Molecular weight | 245.66 g/mol |
| IUPAC name | 4-fluoroisoquinoline-5-sulfonyl chloride |
| InChIKey | UZUCKWMDQGESLP-UHFFFAOYSA-N |
| SMILES | C1=CC2=CN=CC(=C2C(=C1)S(=O)(=O)Cl)F |
Computed by PubChem (NCBI)