CAS 1403754-24-4 is the registry number for Methyl 2-chloro-4-fluorobenzo[d]thiazole-6-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-chloro-4-fluoro-1,3-benzothiazole-6-carboxylate (CAS 1403754-24-4) is a chemical compound with the molecular formula C9H5ClFNO2S and a molecular weight of 245.66 g/mol. IUPAC name: methyl 2-chloro-4-fluoro-1,3-benzothiazole-6-carboxylate. InChIKey: MBCZXROTRSIJOK-UHFFFAOYSA-N.
| Molecular formula | C9H5ClFNO2S |
|---|---|
| Molecular weight | 245.66 g/mol |
| IUPAC name | methyl 2-chloro-4-fluoro-1,3-benzothiazole-6-carboxylate |
| InChIKey | MBCZXROTRSIJOK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C2C(=C1)SC(=N2)Cl)F |
Computed by PubChem (NCBI)