Products 100118-38-5

CAS 100118-38-5 is the registry number for Febuxostat Impurity 42. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-(2-methylpropoxy)benzene-1,3-dicarboxylic acid (CAS 100118-38-5) is a chemical compound with the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. IUPAC name: 4-(2-methylpropoxy)benzene-1,3-dicarboxylic acid. InChIKey: JAMVOROIBGKQOV-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14O5
Molecular weight238.24 g/mol
IUPAC name4-(2-methylpropoxy)benzene-1,3-dicarboxylic acid
InChIKeyJAMVOROIBGKQOV-UHFFFAOYSA-N
SMILESCC(C)COC1=C(C=C(C=C1)C(=O)O)C(=O)O

Computed by PubChem (NCBI)