Products 395087-89-5
CAS 395087-89-5 appears in our catalog under these names: Dibenzo(b,d)Furan–3–Ylboronic Acid, dibenzo[b,d]furan-3-ylboronic acid 98%, Dibenzo[b,d]Furan-3-Ylboronic Acid, 98%, 98%, DIBENZO[B,D]FURAN-3-YLBORONIC ACID, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 100mg, 250mg, 100g, 10g, 50g.
Dibenzofuran-3-ylboronic acid (CAS 395087-89-5) is a chemical compound with the molecular formula C12H9BO3 and a molecular weight of 212.01 g/mol. IUPAC name: dibenzofuran-3-ylboronic acid. InChIKey: FQENSZQWKVWYPA-UHFFFAOYSA-N.
| Molecular formula | C12H9BO3 |
|---|---|
| Molecular weight | 212.01 g/mol |
| IUPAC name | dibenzofuran-3-ylboronic acid |
| InChIKey | FQENSZQWKVWYPA-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)C3=CC=CC=C3O2)(O)O |
Computed by PubChem (NCBI)
Synonyms:
Dibenzo[b,d]furan-3-ylboronic acid, dibenzofuran-3-boronic acid, Dibenzofuran-3-ylboronic acid, B-3-dibenzofuranylBoronic acid, Boronic acid, 3-dibenzofuranyl-, Dibenzo[b,d]furan-3-boronicacid, Dibenzo[b,d]furan-3-ylboronicacid, (3-Dibenzofuranyl)boronic acid, Boronic acid,B-3-dibenzofuranyl-, Dibenzo[B,D]furan-3-yl boronic acid