CAS 1147823-67-3 is the registry number for Methyl 2-(5-bromothiophene-2-carboxamido)-2-methylpropanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-[(5-bromothiophene-2-carbonyl)amino]-2-methylpropanoate (CAS 1147823-67-3) is a chemical compound with the molecular formula C10H12BrNO3S and a molecular weight of 306.18 g/mol. IUPAC name: methyl 2-[(5-bromothiophene-2-carbonyl)amino]-2-methylpropanoate. InChIKey: JBMJZMRZYWGNHL-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO3S |
|---|---|
| Molecular weight | 306.18 g/mol |
| IUPAC name | methyl 2-[(5-bromothiophene-2-carbonyl)amino]-2-methylpropanoate |
| InChIKey | JBMJZMRZYWGNHL-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)OC)NC(=O)C1=CC=C(S1)Br |
Computed by PubChem (NCBI)