Products 1342705-13-8
CAS 1342705-13-8 is the registry number for N-(3-Bromothiophene-2-carbonyl)-N-propylglycine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(3-bromothiophene-2-carbonyl)-propylamino]acetic acid (CAS 1342705-13-8) is a chemical compound with the molecular formula C10H12BrNO3S and a molecular weight of 306.18 g/mol. IUPAC name: 2-[(3-bromothiophene-2-carbonyl)-propylamino]acetic acid. InChIKey: IERSVPNIJUCFFG-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO3S |
|---|---|
| Molecular weight | 306.18 g/mol |
| IUPAC name | 2-[(3-bromothiophene-2-carbonyl)-propylamino]acetic acid |
| InChIKey | IERSVPNIJUCFFG-UHFFFAOYSA-N |
| SMILES | CCCN(CC(=O)O)C(=O)C1=C(C=CS1)Br |
Computed by PubChem (NCBI)