Products 1342523-74-3
CAS 1342523-74-3 is the registry number for 3-(3-Bromo-N-ethylthiophene-2-carboxamido)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(3-bromothiophene-2-carbonyl)-ethylamino]propanoic acid (CAS 1342523-74-3) is a chemical compound with the molecular formula C10H12BrNO3S and a molecular weight of 306.18 g/mol. IUPAC name: 3-[(3-bromothiophene-2-carbonyl)-ethylamino]propanoic acid. InChIKey: OZEDTYOCIIGCDB-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO3S |
|---|---|
| Molecular weight | 306.18 g/mol |
| IUPAC name | 3-[(3-bromothiophene-2-carbonyl)-ethylamino]propanoic acid |
| InChIKey | OZEDTYOCIIGCDB-UHFFFAOYSA-N |
| SMILES | CCN(CCC(=O)O)C(=O)C1=C(C=CS1)Br |
Computed by PubChem (NCBI)