CAS 100136-48-9 appears in our catalog under these names: 4-(7-Methoxy-1-benzofuran-2-yl)-1,3-thiazol-2-amine, 95%, 4-(7-Methoxybenzofuran-2-yl)thiazol-2-amine, 98%, 4-(7-Methoxy-1-benzofuran-2-yl)-1,3-thiazol-2-amine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 50mg, 0,5g.
4-(7-methoxy-1-benzofuran-2-yl)-1,3-thiazol-2-amine (CAS 100136-48-9) is a chemical compound with the molecular formula C12H10N2O2S and a molecular weight of 246.29 g/mol. IUPAC name: 4-(7-methoxy-1-benzofuran-2-yl)-1,3-thiazol-2-amine. InChIKey: VFRZHWUBUSHOHK-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O2S |
|---|---|
| Molecular weight | 246.29 g/mol |
| IUPAC name | 4-(7-methoxy-1-benzofuran-2-yl)-1,3-thiazol-2-amine |
| InChIKey | VFRZHWUBUSHOHK-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C1OC(=C2)C3=CSC(=N3)N |
Computed by PubChem (NCBI)