CAS 6259-19-4 appears in our catalog under these names: 3,7-Diaminodibenzo[b,d]thiophene 5,5-dioxide, 95%, 3,7–Diaminodibenzo(b,d)thiophene 5,5–dioxide, Dibenzo(b,d)thiophene-3,7-diamine 5,5-dioxide, 3,7-Diaminodibenzo[b,d]thiophene 5,5-dioxide 97%, 3,7-Diaminodibenzothiophene-5,5-dioxide, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 5g, 10g, 100mg, 25g.
5,5-dioxodibenzothiophene-3,7-diamine (CAS 6259-19-4) is a chemical compound with the molecular formula C12H10N2O2S and a molecular weight of 246.29 g/mol. IUPAC name: 5,5-dioxodibenzothiophene-3,7-diamine. InChIKey: FUXZRRZSHWQAAA-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O2S |
|---|---|
| Molecular weight | 246.29 g/mol |
| IUPAC name | 5,5-dioxodibenzothiophene-3,7-diamine |
| InChIKey | FUXZRRZSHWQAAA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)S(=O)(=O)C3=C2C=CC(=C3)N |
Computed by PubChem (NCBI)