CAS 1206969-45-0 is the registry number for 8-Methoxy-5h-chromeno[4,3-d]pyrimidine-2-thiol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
8-methoxy-1,5-dihydrochromeno[4,3-d]pyrimidine-2-thione (CAS 1206969-45-0) is a chemical compound with the molecular formula C12H10N2O2S and a molecular weight of 246.29 g/mol. IUPAC name: 8-methoxy-1,5-dihydrochromeno[4,3-d]pyrimidine-2-thione. InChIKey: MCUNWMMIXCXPFA-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O2S |
|---|---|
| Molecular weight | 246.29 g/mol |
| IUPAC name | 8-methoxy-1,5-dihydrochromeno[4,3-d]pyrimidine-2-thione |
| InChIKey | MCUNWMMIXCXPFA-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C3=C(CO2)C=NC(=S)N3 |
Computed by PubChem (NCBI)