CAS 104742-05-4 is the registry number for 2-((4-Nitrobenzyl)sulfanyl)pyridine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g, 100g.
2-[(4-nitrophenyl)methylsulfanyl]pyridine (CAS 104742-05-4) is a chemical compound with the molecular formula C12H10N2O2S and a molecular weight of 246.29 g/mol. IUPAC name: 2-[(4-nitrophenyl)methylsulfanyl]pyridine. InChIKey: SAGZPBGIVZXYBE-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O2S |
|---|---|
| Molecular weight | 246.29 g/mol |
| IUPAC name | 2-[(4-nitrophenyl)methylsulfanyl]pyridine |
| InChIKey | SAGZPBGIVZXYBE-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)SCC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)