CAS 1001395-26-1 is the registry number for 1-(3-Bromo-5-(trifluoromethyl)phenyl)hydrazine. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
[3-bromo-5-(trifluoromethyl)phenyl]hydrazine;hydrochloride (CAS 1001395-26-1) is a chemical compound with the molecular formula C7H7BrClF3N2 and a molecular weight of 291.49 g/mol. IUPAC name: [3-bromo-5-(trifluoromethyl)phenyl]hydrazine;hydrochloride. InChIKey: FAOSUVGNDGPJJC-UHFFFAOYSA-N.
| Molecular formula | C7H7BrClF3N2 |
|---|---|
| Molecular weight | 291.49 g/mol |
| IUPAC name | [3-bromo-5-(trifluoromethyl)phenyl]hydrazine;hydrochloride |
| InChIKey | FAOSUVGNDGPJJC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1NN)Br)C(F)(F)F.Cl |
Computed by PubChem (NCBI)