CAS 529512-78-5 appears in our catalog under these names: 2–Bromo–5–(trifluoromethyl)phenylhydrazine Hydrochloride, 2-Bromo-5-(trifluoromethyl)phenylhydrazine hydrochloride, >95%, 2-Bromo-5-(trifluoromethyl)phenylhydrazine Hydrochloride, >95%, >95%. Offered by: GLPBio, Fluorochem, Chemat. Available pack sizes: 1g, 5g.
[2-bromo-5-(trifluoromethyl)phenyl]hydrazine;hydrochloride (CAS 529512-78-5) is a chemical compound with the molecular formula C7H7BrClF3N2 and a molecular weight of 291.49 g/mol. IUPAC name: [2-bromo-5-(trifluoromethyl)phenyl]hydrazine;hydrochloride. InChIKey: QAEDGRVAFKSCMX-UHFFFAOYSA-N.
| Molecular formula | C7H7BrClF3N2 |
|---|---|
| Molecular weight | 291.49 g/mol |
| IUPAC name | [2-bromo-5-(trifluoromethyl)phenyl]hydrazine;hydrochloride |
| InChIKey | QAEDGRVAFKSCMX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)NN)Br.Cl |
Computed by PubChem (NCBI)