CAS 1391460-89-1 is the registry number for (S)-1-(6-Bromopyridin-2-yl)-2,2,2-trifluoroethan-1-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(1S)-1-(6-bromo-2-pyridinyl)-2,2,2-trifluoroethanamine;hydrochloride (CAS 1391460-89-1) is a chemical compound with the molecular formula C7H7BrClF3N2 and a molecular weight of 291.49 g/mol. IUPAC name: (1S)-1-(6-bromo-2-pyridinyl)-2,2,2-trifluoroethanamine;hydrochloride. InChIKey: DPCXDTPQAHXMGA-RGMNGODLSA-N.
| Molecular formula | C7H7BrClF3N2 |
|---|---|
| Molecular weight | 291.49 g/mol |
| IUPAC name | (1S)-1-(6-bromo-2-pyridinyl)-2,2,2-trifluoroethanamine;hydrochloride |
| InChIKey | DPCXDTPQAHXMGA-RGMNGODLSA-N |
| SMILES | C1=CC(=NC(=C1)Br)[C@@H](C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)