CAS 2702840-43-3 is the registry number for (4-Bromo-3-(trifluoromethyl)phenyl)hydrazine hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g.
[4-bromo-3-(trifluoromethyl)phenyl]hydrazine;hydrochloride (CAS 2702840-43-3) is a chemical compound with the molecular formula C7H7BrClF3N2 and a molecular weight of 291.49 g/mol. IUPAC name: [4-bromo-3-(trifluoromethyl)phenyl]hydrazine;hydrochloride. InChIKey: UEMSPSZEJUOLMS-UHFFFAOYSA-N.
| Molecular formula | C7H7BrClF3N2 |
|---|---|
| Molecular weight | 291.49 g/mol |
| IUPAC name | [4-bromo-3-(trifluoromethyl)phenyl]hydrazine;hydrochloride |
| InChIKey | UEMSPSZEJUOLMS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NN)C(F)(F)F)Br.Cl |
Computed by PubChem (NCBI)