Products 909402-26-2
CAS 909402-26-2 is the registry number for Decitabine Impurity 11. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-methoxy-1,3,5-triazin-2-one (CAS 909402-26-2) is a chemical compound with the molecular formula C9H13N3O5 and a molecular weight of 243.22 g/mol. IUPAC name: 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-methoxy-1,3,5-triazin-2-one. InChIKey: NQDFPKMOONRGHQ-RRKCRQDMSA-N.
| Molecular formula | C9H13N3O5 |
|---|---|
| Molecular weight | 243.22 g/mol |
| IUPAC name | 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-methoxy-1,3,5-triazin-2-one |
| InChIKey | NQDFPKMOONRGHQ-RRKCRQDMSA-N |
| SMILES | COC1=NC(=O)N(C=N1)[C@H]2C[C@@H]([C@H](O2)CO)O |
Computed by PubChem (NCBI)