CAS 1001519-38-5 is the registry number for 4-Chloro-1-methyl-5-(trifluoromethyl)-1H-pyrazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
4-chloro-1-methyl-5-(trifluoromethyl)pyrazole-3-carboxylic acid (CAS 1001519-38-5) is a chemical compound with the molecular formula C6H4ClF3N2O2 and a molecular weight of 228.55 g/mol. IUPAC name: 4-chloro-1-methyl-5-(trifluoromethyl)pyrazole-3-carboxylic acid. InChIKey: ZGXCZXXWVJQHJG-UHFFFAOYSA-N.
| Molecular formula | C6H4ClF3N2O2 |
|---|---|
| Molecular weight | 228.55 g/mol |
| IUPAC name | 4-chloro-1-methyl-5-(trifluoromethyl)pyrazole-3-carboxylic acid |
| InChIKey | ZGXCZXXWVJQHJG-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C(=N1)C(=O)O)Cl)C(F)(F)F |
Computed by PubChem (NCBI)