CAS 128455-63-0 appears in our catalog under these names: 5-Chloro-1-methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid, 95%, 5-Chloro-1-methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid, 95+%, 5-Chloro-1-methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid, 97% , 5-Chloro-1-Methyl-3-(Trifluoromethyl)-1H-Pyrazole-4-Carboxylic Acid, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, Thermo Scientific, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 50mg, 250mg.
5-chloro-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxylic acid (CAS 128455-63-0) is a chemical compound with the molecular formula C6H4ClF3N2O2 and a molecular weight of 228.55 g/mol. IUPAC name: 5-chloro-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxylic acid. InChIKey: IKGVBNQPAJOSFP-UHFFFAOYSA-N.
| Molecular formula | C6H4ClF3N2O2 |
|---|---|
| Molecular weight | 228.55 g/mol |
| IUPAC name | 5-chloro-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxylic acid |
| InChIKey | IKGVBNQPAJOSFP-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C(=N1)C(F)(F)F)C(=O)O)Cl |
Computed by PubChem (NCBI)