Products 1006448-63-0

CAS 1006448-63-0 is the registry number for 4-Chloro-1-(2,2,2-trifluoroethyl)-1H-pyrazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

4-chloro-1-(2,2,2-trifluoroethyl)pyrazole-3-carboxylic acid (CAS 1006448-63-0) is a chemical compound with the molecular formula C6H4ClF3N2O2 and a molecular weight of 228.55 g/mol. IUPAC name: 4-chloro-1-(2,2,2-trifluoroethyl)pyrazole-3-carboxylic acid. InChIKey: XNUPYEQBUFJBPP-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4ClF3N2O2
Molecular weight228.55 g/mol
IUPAC name4-chloro-1-(2,2,2-trifluoroethyl)pyrazole-3-carboxylic acid
InChIKeyXNUPYEQBUFJBPP-UHFFFAOYSA-N
SMILESC1=C(C(=NN1CC(F)(F)F)C(=O)O)Cl

Computed by PubChem (NCBI)