Products 2991434-75-2
CAS 2991434-75-2 appears in our catalog under these names: 3-Chloro-1-(2,2,2-trifluoroethyl)-1H-pyrazole-4-carboxylic acid, 98%, 98%, 3-Chloro-1-(2,2,2-trifluoroethyl)-1H-pyrazole-4-carboxylic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
3-chloro-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxylic acid (CAS 2991434-75-2) is a chemical compound with the molecular formula C6H4ClF3N2O2 and a molecular weight of 228.55 g/mol. IUPAC name: 3-chloro-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxylic acid. InChIKey: BWLLOCPQMVWUBT-UHFFFAOYSA-N.
| Molecular formula | C6H4ClF3N2O2 |
|---|---|
| Molecular weight | 228.55 g/mol |
| IUPAC name | 3-chloro-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxylic acid |
| InChIKey | BWLLOCPQMVWUBT-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NN1CC(F)(F)F)Cl)C(=O)O |
Computed by PubChem (NCBI)