CAS 1001648-71-0 appears in our catalog under these names: Pramipexole USP RC G(BI-II820BS), Pramipexole Impurity 37, Pramipexole Impurity 7(Pramipexole (7S)-Hydroxy Impurity). Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(6S,7S)-2-amino-6-(propylamino)-4,5,6,7-tetrahydro-1,3-benzothiazol-7-ol (CAS 1001648-71-0) is a chemical compound with the molecular formula C10H17N3OS and a molecular weight of 227.33 g/mol. IUPAC name: (6S,7S)-2-amino-6-(propylamino)-4,5,6,7-tetrahydro-1,3-benzothiazol-7-ol. InChIKey: UWNDKVURLHPSSG-XPUUQOCRSA-N.
| Molecular formula | C10H17N3OS |
|---|---|
| Molecular weight | 227.33 g/mol |
| IUPAC name | (6S,7S)-2-amino-6-(propylamino)-4,5,6,7-tetrahydro-1,3-benzothiazol-7-ol |
| InChIKey | UWNDKVURLHPSSG-XPUUQOCRSA-N |
| SMILES | CCCN[C@H]1CCC2=C([C@H]1O)SC(=N2)N |
Computed by PubChem (NCBI)