CAS 2165891-88-1 is the registry number for Pramipexole Impurity 49. Offered by: Chemat Brand. Available pack sizes: on request.
(6R,7S)-2-amino-6-(propylamino)-4,5,6,7-tetrahydro-1,3-benzothiazol-7-ol (CAS 2165891-88-1) is a chemical compound with the molecular formula C10H17N3OS and a molecular weight of 227.33 g/mol. IUPAC name: (6R,7S)-2-amino-6-(propylamino)-4,5,6,7-tetrahydro-1,3-benzothiazol-7-ol. InChIKey: UWNDKVURLHPSSG-SVRRBLITSA-N.
| Molecular formula | C10H17N3OS |
|---|---|
| Molecular weight | 227.33 g/mol |
| IUPAC name | (6R,7S)-2-amino-6-(propylamino)-4,5,6,7-tetrahydro-1,3-benzothiazol-7-ol |
| InChIKey | UWNDKVURLHPSSG-SVRRBLITSA-N |
| SMILES | CCCN[C@@H]1CCC2=C([C@H]1O)SC(=N2)N |
Computed by PubChem (NCBI)