Products 2015199-38-7
CAS 2015199-38-7 is the registry number for (E)-N-((1,4-Dimethyl-1H-pyrazol-5-yl)methylene)-2-methylpropane-2-sulfinamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(NE)-N-[(1,4-dimethylpyrazol-5-yl)methylidene]-2-methylpropane-2-sulfinamide (CAS 2015199-38-7) is a chemical compound with the molecular formula C10H17N3OS and a molecular weight of 227.33 g/mol. IUPAC name: (NE)-N-[(1,4-dimethylpyrazol-5-yl)methylidene]-2-methylpropane-2-sulfinamide. InChIKey: OLOZLTIUBBXGIG-KPKJPENVSA-N.
| Molecular formula | C10H17N3OS |
|---|---|
| Molecular weight | 227.33 g/mol |
| IUPAC name | (NE)-N-[(1,4-dimethylpyrazol-5-yl)methylidene]-2-methylpropane-2-sulfinamide |
| InChIKey | OLOZLTIUBBXGIG-KPKJPENVSA-N |
| SMILES | CC1=C(N(N=C1)C)/C=N/S(=O)C(C)(C)C |
Computed by PubChem (NCBI)