Products 1480982-24-8
CAS 1480982-24-8 is the registry number for N-(4-(1-Aminoethyl)-1,3-thiazol-2-yl)-2,2-dimethylpropanamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
N-[4-(1-aminoethyl)-1,3-thiazol-2-yl]-2,2-dimethylpropanamide (CAS 1480982-24-8) is a chemical compound with the molecular formula C10H17N3OS and a molecular weight of 227.33 g/mol. IUPAC name: N-[4-(1-aminoethyl)-1,3-thiazol-2-yl]-2,2-dimethylpropanamide. InChIKey: KVXOYZWBUQDZAC-UHFFFAOYSA-N.
| Molecular formula | C10H17N3OS |
|---|---|
| Molecular weight | 227.33 g/mol |
| IUPAC name | N-[4-(1-aminoethyl)-1,3-thiazol-2-yl]-2,2-dimethylpropanamide |
| InChIKey | KVXOYZWBUQDZAC-UHFFFAOYSA-N |
| SMILES | CC(C1=CSC(=N1)NC(=O)C(C)(C)C)N |
Computed by PubChem (NCBI)