Products 10017-66-0
CAS 10017-66-0 is the registry number for α-Pseudouridine. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-pyrimidine-2,4-dione (CAS 10017-66-0) is a chemical compound with the molecular formula C9H12N2O6 and a molecular weight of 244.20 g/mol. IUPAC name: 5-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-pyrimidine-2,4-dione. InChIKey: PTJWIQPHWPFNBW-DBRKOABJSA-N.
| Molecular formula | C9H12N2O6 |
|---|---|
| Molecular weight | 244.20 g/mol |
| IUPAC name | 5-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-pyrimidine-2,4-dione |
| InChIKey | PTJWIQPHWPFNBW-DBRKOABJSA-N |
| SMILES | C1=C(C(=O)NC(=O)N1)[C@@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O |
Computed by PubChem (NCBI)