Products 478511-16-9
CAS 478511-16-9 appears in our catalog under these names: (5'-13C)Uridine, Uridine-13C-3. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.
1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxy(113C)methyl)oxolan-2-yl]pyrimidine-2,4-dione (CAS 478511-16-9) is a chemical compound with the molecular formula C9H12N2O6 and a molecular weight of 245.19 g/mol. IUPAC name: 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxy(113C)methyl)oxolan-2-yl]pyrimidine-2,4-dione. InChIKey: DRTQHJPVMGBUCF-GYMNKEIPSA-N.
| Molecular formula | C9H12N2O6 |
|---|---|
| Molecular weight | 245.19 g/mol |
| IUPAC name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxy(113C)methyl)oxolan-2-yl]pyrimidine-2,4-dione |
| InChIKey | DRTQHJPVMGBUCF-GYMNKEIPSA-N |
| SMILES | C1=CN(C(=O)NC1=O)[C@H]2[C@@H]([C@@H]([C@H](O2)[13CH2]O)O)O |
Computed by PubChem (NCBI)
Synonyms:
[5'-13C]uridine, Uridine 13C-3