Products 202406-84-6
CAS 202406-84-6 appears in our catalog under these names: Uridine- 13C9, 15N2, Uridine–13C9, 15N2, Uridine-13C9,15N2, 99.0%. Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 25mg, 1mg (100mM * 0,039ml in water), 1mg, 1 mg (100 mM * 0.039 mL in Water).
1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxy(113C)methyl)(2,3,4,5-13C4)oxolan-2-yl](2,4,5,6-13C4,1,3-15N2)pyrimidine-2,4-dione (CAS 202406-84-6) is a chemical compound with the molecular formula C9H12N2O6 and a molecular weight of 255.12 g/mol. IUPAC name: 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxy(113C)methyl)(2,3,4,5-13C4)oxolan-2-yl](2,4,5,6-13C4,1,3-15N2)pyrimidine-2,4-dione. InChIKey: DRTQHJPVMGBUCF-SBBTXHCQSA-N.
| Molecular formula | C9H12N2O6 |
|---|---|
| Molecular weight | 255.12 g/mol |
| IUPAC name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxy(113C)methyl)(2,3,4,5-13C4)oxolan-2-yl](2,4,5,6-13C4,1,3-15N2)pyrimidine-2,4-dione |
| InChIKey | DRTQHJPVMGBUCF-SBBTXHCQSA-N |
| SMILES | [13CH]1=[13CH][15N]([13C](=O)[15NH][13C]1=O)[13C@H]2[13C@@H]([13C@@H]([13C@H](O2)[13CH2]O)O)O |
Computed by PubChem (NCBI)
Synonyms:
Uridine-13C9,15N2, Uridine- 13C9, 15N2