CAS 26287-69-4 appears in our catalog under these names: L-Uridine, 98%, L–Uridine, L-Uridine/ 99.57% (existing batch purity), L-Uridine, L-Uridine 98%. Offered by: Combi-blocks, AmBeed, GLPBio, TargetMol, Biosynth. Available pack sizes: 250mg, 1g, 5g, 25g, 5mg, 100mg, 50mg, 25mg.
1-[(2S,3S,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (CAS 26287-69-4) is a chemical compound with the molecular formula C9H12N2O6 and a molecular weight of 244.20 g/mol. IUPAC name: 1-[(2S,3S,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione. InChIKey: DRTQHJPVMGBUCF-PSQAKQOGSA-N.
| Molecular formula | C9H12N2O6 |
|---|---|
| Molecular weight | 244.20 g/mol |
| IUPAC name | 1-[(2S,3S,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| InChIKey | DRTQHJPVMGBUCF-PSQAKQOGSA-N |
| SMILES | C1=CN(C(=O)NC1=O)[C@@H]2[C@H]([C@H]([C@@H](O2)CO)O)O |
Computed by PubChem (NCBI)