CAS 100184-66-5 appears in our catalog under these names: 5-Amino-2-naphthoic acid 95%, 5-Amino-2-naphthalenecarboxylic acid, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 1g, 50mg, 100mg, 250mg.
5-aminonaphthalene-2-carboxylic acid (CAS 100184-66-5) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: 5-aminonaphthalene-2-carboxylic acid. InChIKey: XVOBQVZYYPJXCK-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | 5-aminonaphthalene-2-carboxylic acid |
| InChIKey | XVOBQVZYYPJXCK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)C(=O)O)C(=C1)N |
Computed by PubChem (NCBI)