Products 1001852-14-7
CAS 1001852-14-7 appears in our catalog under these names: Pomalidomide Impurity 14, 2-Amino-6-((2,6-dioxopiperidin-3-yl)carbamoyl)benzoic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg.
2-amino-6-[(2,6-dioxopiperidin-3-yl)carbamoyl]benzoic acid (CAS 1001852-14-7) is a chemical compound with the molecular formula C13H13N3O5 and a molecular weight of 291.26 g/mol. IUPAC name: 2-amino-6-[(2,6-dioxopiperidin-3-yl)carbamoyl]benzoic acid. InChIKey: WUCFRUNKXKEODY-UHFFFAOYSA-N.
| Molecular formula | C13H13N3O5 |
|---|---|
| Molecular weight | 291.26 g/mol |
| IUPAC name | 2-amino-6-[(2,6-dioxopiperidin-3-yl)carbamoyl]benzoic acid |
| InChIKey | WUCFRUNKXKEODY-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1NC(=O)C2=C(C(=CC=C2)N)C(=O)O |
Computed by PubChem (NCBI)