Products 105902-18-9
CAS 105902-18-9 is the registry number for 2-Acetamido-3-(6-nitro-1H-indol-3-yl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-acetamido-3-(6-nitro-1H-indol-3-yl)propanoic acid (CAS 105902-18-9) is a chemical compound with the molecular formula C13H13N3O5 and a molecular weight of 291.26 g/mol. IUPAC name: 2-acetamido-3-(6-nitro-1H-indol-3-yl)propanoic acid. InChIKey: WBPJKEYZMQDFMS-UHFFFAOYSA-N.
| Molecular formula | C13H13N3O5 |
|---|---|
| Molecular weight | 291.26 g/mol |
| IUPAC name | 2-acetamido-3-(6-nitro-1H-indol-3-yl)propanoic acid |
| InChIKey | WBPJKEYZMQDFMS-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(CC1=CNC2=C1C=CC(=C2)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)