CAS 918314-45-1 appears in our catalog under these names: Pomalidomide M10, Pomalidomide Impurity C, Pomalidomide Impurity 5, Hydrolyzed Pomalidomide M10, >95% (HPLC), Hydrolyzed pomalidomide M10. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
5-amino-4-(4-amino-1,3-dioxoisoindol-2-yl)-5-oxopentanoic acid (CAS 918314-45-1) is a chemical compound with the molecular formula C13H13N3O5 and a molecular weight of 291.26 g/mol. IUPAC name: 5-amino-4-(4-amino-1,3-dioxoisoindol-2-yl)-5-oxopentanoic acid. InChIKey: JVYMXRZSOURPSE-UHFFFAOYSA-N.
| Molecular formula | C13H13N3O5 |
|---|---|
| Molecular weight | 291.26 g/mol |
| IUPAC name | 5-amino-4-(4-amino-1,3-dioxoisoindol-2-yl)-5-oxopentanoic acid |
| InChIKey | JVYMXRZSOURPSE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)N)C(=O)N(C2=O)C(CCC(=O)O)C(=O)N |
Computed by PubChem (NCBI)