CAS 1001852-15-8 appears in our catalog under these names: Pomalidomide Impurity 12, Pomalidomide Impurity 9, 3-Amino-2-(((2,6-dioxo-3-piperidinyl)amino)carbonyl)benzoic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
3-amino-2-[(2,6-dioxopiperidin-3-yl)carbamoyl]benzoic acid (CAS 1001852-15-8) is a chemical compound with the molecular formula C13H13N3O5 and a molecular weight of 291.26 g/mol. IUPAC name: 3-amino-2-[(2,6-dioxopiperidin-3-yl)carbamoyl]benzoic acid. InChIKey: JJGPJHBPFFMAEV-UHFFFAOYSA-N.
| Molecular formula | C13H13N3O5 |
|---|---|
| Molecular weight | 291.26 g/mol |
| IUPAC name | 3-amino-2-[(2,6-dioxopiperidin-3-yl)carbamoyl]benzoic acid |
| InChIKey | JJGPJHBPFFMAEV-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1NC(=O)C2=C(C=CC=C2N)C(=O)O |
Computed by PubChem (NCBI)