CAS 1001940-36-8 is the registry number for 2-(3,5-Dichlorophenyl)-morpholine hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-(3,5-dichlorophenyl)morpholine (CAS 1001940-36-8) is a chemical compound with the molecular formula C10H11Cl2NO and a molecular weight of 232.10 g/mol. IUPAC name: 2-(3,5-dichlorophenyl)morpholine. InChIKey: FLCUDNDPRMIYHA-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2NO |
|---|---|
| Molecular weight | 232.10 g/mol |
| IUPAC name | 2-(3,5-dichlorophenyl)morpholine |
| InChIKey | FLCUDNDPRMIYHA-UHFFFAOYSA-N |
| SMILES | C1COC(CN1)C2=CC(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)